|
|
|
|
|
Acrivastine |
|
C22H24N2O2 |
|
87848-99-5 |
|
usage:It is a second-generation H1-receptor antagonist antihistamine and works by blocking Histamine H1 receptors.
Contact me at ycswendy at gmail .com
|
|
Acrivastine Molecular Formula C22H24N2O2 Molecular Weight 348.44 CAS Registry Number 87848-99-5 product Name Acrivastine Molecular Formula C22H24N2O2 Molecular Weight 348.44 InChI InChI=1/C22H24N2O2/c1-17-7-9-18(10-8-17)20(13-16-24-14-2-3-15-24)21-6-4-5-19(23-21)11-12-22(25)26/h4-13H,2-3,14-16H2,1H3,(H,25,26)/b12-11+,20-13+ CAS Registry Number 87848-99-5 Content: 99% Packing: 5Kg / tin ,25kg / barrel |
Industrial field |
pharmaceutical |
|
|
|
|
|
|
|
There are no existing companies to distribute selected chemical product |
|
|
|
|
|