 |
 |
|
|
|
Cisatrcurium Besylate |
 |
99% powder |
 |
96946-42-8 |
 |
It is applied to all kinds of surgical to make the skeletal muscle relaxation, control the breathing, especially when applied to the required intubation and muscle relaxation of caesarean section when muscle relaxation. |
 |
Also used for continuous infusion to maintain the long surgery in neuromuscular block. Molecular Formula:C53H72N2O12.2(C6H5O3S) CAS : 96946-42-8
|
Industrial field |
pharmaceutical |
|
|
 |
|
|
|
 |
There are no existing companies to distribute selected chemical product |
|
 |
|
|
|