 |
 |
|
|
|
| Silane Coupling Agent KH-560 |
 |
| 3-glycidoxypropyltrimethoxysilane. |
 |
| 2530-83-8 |
 |
The use of the product 1) KH-560 is used in epoxy adhesives and polysulfide sealants. It improves adhesion. 2) KH-560 is used in glass fiber to reinforce epoxy resin. It can improve the physical properties, especially the wet strength of the composite. 3) KH-560 is used in mineral filled composites. These composites are aluminum hydroxide, silica, mica, wollastonite, and pearls of glass. 4) KH-560 should be stored in closed containers in a day place. The shelf life is not less than half year. |
 |
1.The corresponding foreign trademark A-187 (UCC, America), Z-6040 (Dow Corring, America), KBM-403 (Japan)
2.Chemical designation 3-glycidoxypropyltrimethoxysilane.
3.Chemical structural formula CH2-CH-CH2-OCH2CH2CH2SI(OCH3)3 \ / 0
4.Property This product is a transparent liquid, which is colorless. It can dissolve in benzene, acetone, carbon tetrachloride, which cannot dissolve in water. Boiling point at 760mmHg:290ЎЙ,Apparent Specific Gravity 25/25ЎЙ,1.069,Refractive Index/25ЎЙ,1.427,Flash point,110ЎЙ. |
| Industrial field |
inorganic chemicals, organo silicone, others |
|
|
 |
|
|
|
|
|
 |
| There are no existing companies to distribute selected chemical product |
|
 |
|
|
|