 |
 |
|
|
|
| Forchlorfenuron |
 |
| N-(2-chloro-4-pyridinyl)-N'-phenylurea ; KT-30 |
 |
| 68157-60-8 |
 |
| Plant growth regulator with cytokinin activity. The bioavailability of KT-30 is 10-100 times of that of 6BA. It is widely used in agriculture, horticulture and fruit. It can promote cell division and expansion, enlarge fruit, increase crop yield, etc. |
 |
Molecular Formula: C12H10ClN3O
Molecular Weight: 247.68
Appearance: White crystals
Melting Point: 171-173¡ÆC
|
| Industrial field |
agrochemical, biocide, fungicide, pharmaceutical |
|
|
 |
|
|
|
|
|
 |
| There are no existing companies to distribute selected chemical product |
|
 |
|
|
|
