 |
 |
|
|
|
| inositol niacinate |
 |
| white powder |
 |
| 6556-11-2 |
 |
| Usage:A flush-free form of niacin (vitamin b3). |
 |
inositol niacinate
Name:inositol niacinate EINECS:229-485-9 Molecular Formula:C42H30N6O12 CAS :6556-11-2 Synonyms:myo-inositol hexanicotinate Inositol Nicotinate Inositol Hexanicotinate InChI:InChI=1/C42H30N6O12/c49-37(25-7-1-13-43-19-25)55-31-32(56-38(50)26-8-2-14-44-20-26)34(58-40(52)28-10-4-16-46-22-28)36(60-42(54)30-12-6-18-48-24-30)35(59-41(53)29-11-5-17-47-23-29)33(31)57-39(51)27-9-3-15-45-21-27/h1-24,31-36H
Appearance:white powder Package:25KG/DRUM Standard:enterprise standard Assay:99% Molecular Weight:810.73 Density:1.5g/cm3 Boiling Point:897¡ÆC at 760 mmHg Melting Point:254-256¡É Flash Point:496.3¡ÆC Storage Temperature:Keep tightly closed. Store in a cool dry place. Refractive index:1.674 Usage:A flush-free form of niacin (vitamin b3). |
| Industrial field |
pharmaceutical |
|
|
 |
|
|
|
|
|
 |
| There are no existing companies to distribute selected chemical product |
|
 |
|
|
|