|
|
|
|
|
Triclosan |
|
white to off-white powder |
|
3380-34-5 |
|
pharmaceutical raw material ,intermediates |
|
Triclosan
Name:Triclosan Other name :5-Chloro-2-(2,4-dichlorophenoxy)phenol EINECS:222-182-2 Molecular Formula:C12H7Cl3O2 CAS:3380-34-5 Package:25KG/DRUM Standard:enterprise standard Assay:99%
Synonyms:Phenol,5-chloro-2-(2,4-dichlorophenoxy)- Irgacide LP 10 Irgasan CH 3565 CH 3565 Irgasan PG 60 5-Chloro-2-(2,4-dichlorophenoxy)phenol Zilesan UW Irgasan Irgasan DP 300 Irgasan DP 30 Irgasan PE 30 Triclosin VIV 20 (Triclosan) AZAMETHIPHOS ALT-TCS Triclosan (USP & 5000) CAS No:-3380-34-5 Triclosan (USP & 5000) triclosan 5-chloro-2-(2,4-dichlorophenoxy)phenol 2,4,4'-Trichloro-2'-hydroxy diphenylether (Triclosan) 2,4,4¡Ç-TRICHLORO-2¡Ç-HYDROXYDIPHENYL ETHER 5-CHLORO-2-(2,4-DICHLOROPHENOXYPHENOL) IRGASAN DP300 TCC 2¡Ç-HYDROXY-2,4,4¡Ç-TRICHLORO-PHENYLETHER 5-Chloro-2-(2,4-dichlorophenoxy) phen (Triclosan ) 5-CHLORO-2-(2,4-DICHLOROPHENOXY)PHENOL 99% Triclosan ,3380-34-5 Triclosan/DP300/5-Chloro-2-(2,4-dichlorophenoxy)phenol InChI:InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H
Appearance:white to off-white powder Molecular Weight:289.542 Density:1.49 g/cm3 Boiling Point:344.6 oC at 760 mmHg Melting Point:56-60¡É Flash Point:162.2 oC Stability:Stable. Incompatible with strong oxidizing agents. |
Industrial field |
pharmaceutical |
|
|
|
|
|
|
|
There are no existing companies to distribute selected chemical product |
|
|
|
|
|