|
|
|
|
|
4-Methylcinnamic acid |
|
4-Methylcinnamic acid |
|
It can be used for organic synthesize intermediate
|
|
product Name 4-Methylcinnamic acid
Synonyms 4-Methylcinnamic acid,predominantly trans p-methyl cinnamic acid
Molecular Formula C10H10O2
Molecular Weight 162.19
InChI InChI=1/C10H10O2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+
CAS Registry Number 1866-39-3
EINECS 217-479-9
Molecular Structure
Melting point 198-201ЎЙ
Appearance:white crystal powder,it can be solved in ethanol, ethyl acetate and other organic solvent.
UsageЈєIt can be used for organic synthesize intermediate
Assay :99%
Packing: 25kg net/bag or box.
Brand: Nanjian
|
Industrial field |
additive |
|
|
|
|
|
|
|
There are no existing companies to distribute selected chemical product |
|
|
|
|
|