|
|
|
|
|
Benzocaine |
|
Anaesthesinum |
|
94-09-7 |
|
Usage: For cosmetic UV absorption, local anesthetics, for wounds, ulcers and hemorrhoids facial pain
|
|
Assay: 99.0%¡£ Appearance: Colorless rhomboid crystals, odorless and tasteless Alias: Anaesthesine¡¢Anaesthesinum¡¢Anesthamine¡¢Benzocainum¡¢Ethoforme¡¢Ethyl Aminobenzoate¡¢Ethylis Aminobenzoas¡¡¡¡¡¡ CAS No: 94-09-7 EINECS: 202-303-5 MF: C9H11NO2 InChI: InChI=1/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3¡¡ MW: 165.19 melting point: 88¢¦91¡É Boiling point: 172¡É (17 torr)
|
Industrial field |
pharmaceutical |
|
|
|
|
|
|
|
There are no existing companies to distribute selected chemical product |
|
|
|
|
|